C18H23NO5 — CID 170331971
5-(cyclohexylmethoxy)-4-methoxy-2-(prop-2-enoylamino)benzoic acid (PubChem CID 170331971) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 5-(cyclohexylmethoxy)-4-methoxy-2-(prop-2-enoylamino)benzoic acid.
| Compound Name | 5-(cyclohexylmethoxy)-4-methoxy-2-(prop-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 170331971 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(cyclohexylmethoxy)-4-methoxy-2-(prop-2-enoylamino)benzoic acid |
| SMILES | C=CC(=O)Nc1cc(OC)c(OCC2CCCCC2)cc1C(=O)O |
| InChI | InChI=1S/C18H23NO5/c1-3-17(20)19-14-10-15(23-2)16(9-13(14)18(21)22)24-11-12-7-5-4-6-8-12/h3,9-10,12H,1,4-8,11H2,2H3,(H,19,20)(H,21,22) |
| InChIKey | DHVMSWOPWKLGFN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|