C22H29N7O4 — CID 170338279
3-(methoxymethoxy)-N-[4-[(7-morpholin-4-yl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)oxy]cyclohexyl]pyridin-2-amine (PubChem CID 170338279) has the molecular formula C22H29N7O4 and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-(methoxymethoxy)-N-[4-[(7-morpholin-4-yl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)oxy]cyclohexyl]pyridin-2-amine.
| Compound Name | 3-(methoxymethoxy)-N-[4-[(7-morpholin-4-yl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)oxy]cyclohexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 170338279 |
| Molecular Formula | C22H29N7O4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-(methoxymethoxy)-N-[4-[(7-morpholin-4-yl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)oxy]cyclohexyl]pyridin-2-amine |
| SMILES | COCOc1cccnc1NC1CCC(Oc2nc(N3CCOCC3)cc3ncnn23)CC1 |
| InChI | InChI=1S/C22H29N7O4/c1-30-15-32-18-3-2-8-23-21(18)26-16-4-6-17(7-5-16)33-22-27-20(28-9-11-31-12-10-28)13-19-24-14-25-29(19)22/h2-3,8,13-14,16-17H,4-7,9-12,15H2,1H3,(H,23,26) |
| InChIKey | LFJSSXIJFHHYCP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|