C23H23F2IN2O6S — CID 170338728
N-[4-[[3-(1,1-difluoroethoxy)phenyl]sulfamoyl]-3-ethoxyphenyl]-N-iodo-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 170338728) has the molecular formula C23H23F2IN2O6S and a molecular weight of 620.41 g/mol. Its IUPAC name is N-[4-[[3-(1,1-difluoroethoxy)phenyl]sulfamoyl]-3-ethoxyphenyl]-N-iodo-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[4-[[3-(1,1-difluoroethoxy)phenyl]sulfamoyl]-3-ethoxyphenyl]-N-iodo-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 170338728 |
| Molecular Formula | C23H23F2IN2O6S |
| Molecular Weight | 620.41 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | N-[4-[[3-(1,1-difluoroethoxy)phenyl]sulfamoyl]-3-ethoxyphenyl]-N-iodo-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCOc1cc(N(I)C(=O)C2CC3C=CC2O3)ccc1S(=O)(=O)Nc1cccc(OC(C)(F)F)c1 |
| InChI | InChI=1S/C23H23F2IN2O6S/c1-3-32-20-12-15(28(26)22(29)18-13-16-8-9-19(18)33-16)7-10-21(20)35(30,31)27-14-5-4-6-17(11-14)34-23(2,24)25/h4-12,16,18-19,27H,3,13H2,1-2H3 |
| InChIKey | XLRODQCLUYDSBU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|