C29H36N2O5S — CID 170343766
(2E,4Z,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethyl-20-oxo-20-(thiomorpholine-2-carbonylamino)oxyicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid (PubChem CID 170343766) has the molecular formula C29H36N2O5S and a molecular weight of 524.68 g/mol. Its IUPAC name is (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethyl-20-oxo-20-(thiomorpholine-2-carbonylamino)oxyicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid.
| Compound Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethyl-20-oxo-20-(thiomorpholine-2-carbonylamino)oxyicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
|---|---|
| PubChem CID | 170343766 |
| Molecular Formula | C29H36N2O5S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethyl-20-oxo-20-(thiomorpholine-2-carbonylamino)oxyicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| SMILES | CC(=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C(=O)ONC(=O)C1CNCCS1)/C=C/C(=O)O |
| InChI | InChI=1S/C29H36N2O5S/c1-22(11-7-13-24(3)15-17-27(32)33)9-5-6-10-23(2)12-8-14-25(4)16-18-28(34)36-31-29(35)26-21-30-19-20-37-26/h5-18,26,30H,19-21H2,1-4H3,(H,31,35)(H,32,33)/b6-5+,11-7+,12-8+,17-15+,18-16+,22-9+,23-10+,24-13-,25-14+ |
| InChIKey | ONVMWMIFRPPJTM-ZLNILGNLSA-N |
| XLogP | 4.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|