C26H32FN3O2 — CID 170353184
(10R,15S)-10-ethyl-12-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 170353184) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is (10R,15S)-10-ethyl-12-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-10-ethyl-12-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 170353184 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (10R,15S)-10-ethyl-12-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CC[C@@]12CN(CCCC(O)c3ccc(F)cc3)CC[C@@H]1N1CC(=O)N(C)c3cccc2c31 |
| InChI | InChI=1S/C26H32FN3O2/c1-3-26-17-29(14-5-8-22(31)18-9-11-19(27)12-10-18)15-13-23(26)30-16-24(32)28(2)21-7-4-6-20(26)25(21)30/h4,6-7,9-12,22-23,31H,3,5,8,13-17H2,1-2H3/t22?,23-,26-/m0/s1 |
| InChIKey | KMBIGSKAQXOJGS-RGXIATLPSA-N |
| XLogP | 3.86 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |