C26H32FN3O — CID 170354023
10-ethyl-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 170354023) has the molecular formula C26H32FN3O and a molecular weight of 421.56 g/mol. Its IUPAC name is 10-ethyl-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | 10-ethyl-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 170354023 |
| Molecular Formula | C26H32FN3O |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 10-ethyl-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | CCC12CN(CCCCc3ccc(F)cc3)CCC1N1CC(=O)N(C)c3cccc2c31 |
| InChI | InChI=1S/C26H32FN3O/c1-3-26-18-29(15-5-4-7-19-10-12-20(27)13-11-19)16-14-23(26)30-17-24(31)28(2)22-9-6-8-21(26)25(22)30/h6,8-13,23H,3-5,7,14-18H2,1-2H3 |
| InChIKey | DOYXFGIFEVBVJQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|