C24H32FN5 — CID 154940634
(10S,15S)-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-10,15-diamine (PubChem CID 154940634) has the molecular formula C24H32FN5 and a molecular weight of 409.55 g/mol. Its IUPAC name is (10S,15S)-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-10,15-diamine.
| Compound Name | (10S,15S)-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-10,15-diamine |
|---|---|
| PubChem CID | 154940634 |
| Molecular Formula | C24H32FN5 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (10S,15S)-12-[4-(4-fluorophenyl)butyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-10,15-diamine |
| SMILES | CN1CCN2c3c1cccc3[C@]1(N)CN(CCCCc3ccc(F)cc3)CC[C@]21N |
| InChI | InChI=1S/C24H32FN5/c1-28-15-16-30-22-20(6-4-7-21(22)28)23(26)17-29(14-12-24(23,30)27)13-3-2-5-18-8-10-19(25)11-9-18/h4,6-11H,2-3,5,12-17,26-27H2,1H3/t23-,24+/m1/s1 |
| InChIKey | JOBFDLFCGRHDKY-RPWUZVMVSA-N |
| XLogP | 2.63 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|