C19H16N4O — CID 170357892
4-[(pyridin-4-ylamino)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenol (PubChem CID 170357892) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[(pyridin-4-ylamino)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenol.
| Compound Name | 4-[(pyridin-4-ylamino)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 170357892 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-[(pyridin-4-ylamino)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenol |
| SMILES | Oc1ccc(C(Nc2ccncc2)c2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C19H16N4O/c24-15-5-3-13(4-6-15)18(23-14-7-10-20-11-8-14)17-12-22-19-16(17)2-1-9-21-19/h1-12,18,24H,(H,20,23)(H,21,22) |
| InChIKey | FPSQIBTVQDZTLQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |