C16H20ClN5O4 — CID 170360356
(E,4E)-4-[2,2-bis(2-hydroxyethyl)-3-methyl-5-oxoimidazolidin-4-ylidene]-4-chloro-2-(pyrimidin-4-ylamino)but-2-enal (PubChem CID 170360356) has the molecular formula C16H20ClN5O4 and a molecular weight of 381.82 g/mol. Its IUPAC name is (E,4E)-4-[2,2-bis(2-hydroxyethyl)-3-methyl-5-oxoimidazolidin-4-ylidene]-4-chloro-2-(pyrimidin-4-ylamino)but-2-enal.
| Compound Name | (E,4E)-4-[2,2-bis(2-hydroxyethyl)-3-methyl-5-oxoimidazolidin-4-ylidene]-4-chloro-2-(pyrimidin-4-ylamino)but-2-enal |
|---|---|
| PubChem CID | 170360356 |
| Molecular Formula | C16H20ClN5O4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (E,4E)-4-[2,2-bis(2-hydroxyethyl)-3-methyl-5-oxoimidazolidin-4-ylidene]-4-chloro-2-(pyrimidin-4-ylamino)but-2-enal |
| SMILES | CN1/C(=C(Cl)\C=C(/C=O)Nc2ccncn2)C(=O)NC1(CCO)CCO |
| InChI | InChI=1S/C16H20ClN5O4/c1-22-14(15(26)21-16(22,3-6-23)4-7-24)12(17)8-11(9-25)20-13-2-5-18-10-19-13/h2,5,8-10,23-24H,3-4,6-7H2,1H3,(H,21,26)(H,18,19,20)/b11-8+,14-12+ |
| InChIKey | ADRMTDLCEBVZOC-RKZGRAQHSA-N |
| XLogP | -0.06 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|