C20H27N3O4 — CID 170380641
tert-butyl 4-[2-methyl-7-(methylcarbamoyl)-1-benzofuran-4-yl]piperazine-1-carboxylate (PubChem CID 170380641) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-7-(methylcarbamoyl)-1-benzofuran-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-7-(methylcarbamoyl)-1-benzofuran-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170380641 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl 4-[2-methyl-7-(methylcarbamoyl)-1-benzofuran-4-yl]piperazine-1-carboxylate |
| SMILES | CNC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c2cc(C)oc12 |
| InChI | InChI=1S/C20H27N3O4/c1-13-12-15-16(7-6-14(17(15)26-13)18(24)21-5)22-8-10-23(11-9-22)19(25)27-20(2,3)4/h6-7,12H,8-11H2,1-5H3,(H,21,24) |
| InChIKey | JOLHSPUPRPUHLV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |