C30H41N3O — CID 17039087
3-(1-adamantylimino)-2-phenyl-4-piperidin-1-yl-2-azaspiro[4.5]decan-1-one (PubChem CID 17039087) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 3-(1-adamantylimino)-2-phenyl-4-piperidin-1-yl-2-azaspiro[4.5]decan-1-one.
| Compound Name | 3-(1-adamantylimino)-2-phenyl-4-piperidin-1-yl-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 17039087 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 3-(1-adamantylimino)-2-phenyl-4-piperidin-1-yl-2-azaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccccc2)/C(=N\C23CC4CC(CC(C4)C2)C3)C(N2CCCCC2)C12CCCCC2 |
| InChI | InChI=1S/C30H41N3O/c34-28-30(12-6-2-7-13-30)26(32-14-8-3-9-15-32)27(33(28)25-10-4-1-5-11-25)31-29-19-22-16-23(20-29)18-24(17-22)21-29/h1,4-5,10-11,22-24,26H,2-3,6-9,12-21H2/b31-27- |
| InChIKey | JPWALHSQSADKOO-QVTSOHHYSA-N |
| XLogP | 6.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|