C9H10N6OS — CID 170410539
8-propyl-12-sulfanylidene-1,4,5,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one (PubChem CID 170410539) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is 8-propyl-12-sulfanylidene-1,4,5,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one.
| Compound Name | 8-propyl-12-sulfanylidene-1,4,5,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 170410539 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 8-propyl-12-sulfanylidene-1,4,5,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-7-one |
| SMILES | CCCn1c(=O)c2[nH]ncc2n2c(=S)[nH]nc12 |
| InChI | InChI=1S/C9H10N6OS/c1-2-3-14-7(16)6-5(4-10-11-6)15-8(14)12-13-9(15)17/h4H,2-3H2,1H3,(H,10,11)(H,13,17) |
| InChIKey | RWKYEPSEMTZSJU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|