C21H20ClN5O4S — CID 170417935
6-chloro-3-[[(1R)-1-[6-methyl-2-(1-methylpyrazol-4-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide (PubChem CID 170417935) has the molecular formula C21H20ClN5O4S and a molecular weight of 473.94 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[6-methyl-2-(1-methylpyrazol-4-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[6-methyl-2-(1-methylpyrazol-4-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 170417935 |
| Molecular Formula | C21H20ClN5O4S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[6-methyl-2-(1-methylpyrazol-4-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3cnn(C)c3)cc(=O)c2c1 |
| InChI | InChI=1S/C21H20ClN5O4S/c1-11-6-14(12(2)25-16-4-5-19(22)26-21(16)32(23,29)30)20-15(7-11)17(28)8-18(31-20)13-9-24-27(3)10-13/h4-10,12,25H,1-3H3,(H2,23,29,30)/t12-/m1/s1 |
| InChIKey | WIZKVUGRROFGGU-GFCCVEGCSA-N |
| XLogP | 3.37 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|