C25H22ClN5O4S — CID 170417983
6-chloro-3-[[(1R)-1-[6-methyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide (PubChem CID 170417983) has the molecular formula C25H22ClN5O4S and a molecular weight of 524.00 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[6-methyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-3-[[(1R)-1-[6-methyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 170417983 |
| Molecular Formula | C25H22ClN5O4S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[6-methyl-2-(2-methylindazol-5-yl)-4-oxochromen-8-yl]ethyl]amino]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3ccc4nn(C)cc4c3)cc(=O)c2c1 |
| InChI | InChI=1S/C25H22ClN5O4S/c1-13-8-17(14(2)28-20-6-7-23(26)29-25(20)36(27,33)34)24-18(9-13)21(32)11-22(35-24)15-4-5-19-16(10-15)12-31(3)30-19/h4-12,14,28H,1-3H3,(H2,27,33,34)/t14-/m1/s1 |
| InChIKey | NHHHJTKMPQJKKQ-CQSZACIVSA-N |
| XLogP | 4.52 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|