C26H23ClN4O5S — CID 174153195
3-[[(1R)-1-[3-(1-amino-3-oxoprop-1-en-2-yl)-6-methyl-4-oxo-2-phenylchromen-8-yl]ethyl]amino]-6-chloropyridine-2-sulfonamide (PubChem CID 174153195) has the molecular formula C26H23ClN4O5S and a molecular weight of 539.01 g/mol. Its IUPAC name is 3-[[(1R)-1-[3-(1-amino-3-oxoprop-1-en-2-yl)-6-methyl-4-oxo-2-phenylchromen-8-yl]ethyl]amino]-6-chloropyridine-2-sulfonamide.
| Compound Name | 3-[[(1R)-1-[3-(1-amino-3-oxoprop-1-en-2-yl)-6-methyl-4-oxo-2-phenylchromen-8-yl]ethyl]amino]-6-chloropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 174153195 |
| Molecular Formula | C26H23ClN4O5S |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 3-[[(1R)-1-[3-(1-amino-3-oxoprop-1-en-2-yl)-6-methyl-4-oxo-2-phenylchromen-8-yl]ethyl]amino]-6-chloropyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2S(N)(=O)=O)c2oc(-c3ccccc3)c(C(C=O)=CN)c(=O)c2c1 |
| InChI | InChI=1S/C26H23ClN4O5S/c1-14-10-18(15(2)30-20-8-9-21(27)31-26(20)37(29,34)35)25-19(11-14)23(33)22(17(12-28)13-32)24(36-25)16-6-4-3-5-7-16/h3-13,15,30H,28H2,1-2H3,(H2,29,34,35)/t15-/m1/s1 |
| InChIKey | AIDIDPXNXDGXFN-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|