C27H46N2O6 — CID 170418537
tert-butyl (2S)-2-[[(2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-(2,2-dimethoxyethyl)amino]hexanoate (PubChem CID 170418537) has the molecular formula C27H46N2O6 and a molecular weight of 494.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-(2,2-dimethoxyethyl)amino]hexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-(2,2-dimethoxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 170418537 |
| Molecular Formula | C27H46N2O6 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-(2,2-dimethoxyethyl)amino]hexanoate |
| SMILES | CCCC[C@@H](C(=O)OC(C)(C)C)N(CC(OC)OC)C(=O)[C@@H](N)Cc1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H46N2O6/c1-10-11-12-22(25(31)35-27(5,6)7)29(18-23(32-8)33-9)24(30)21(28)17-19-13-15-20(16-14-19)34-26(2,3)4/h13-16,21-23H,10-12,17-18,28H2,1-9H3/t21-,22-/m0/s1 |
| InChIKey | MRCJTRXIRQUVLG-VXKWHMMOSA-N |
| XLogP | 4.08 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|