C10H10F3NS — CID 170421458
4-(2,2-difluoroethenyl)-2-fluoro-5-methyl-3-methylsulfanylaniline (PubChem CID 170421458) has the molecular formula C10H10F3NS and a molecular weight of 233.26 g/mol. Its IUPAC name is 4-(2,2-difluoroethenyl)-2-fluoro-5-methyl-3-methylsulfanylaniline.
| Compound Name | 4-(2,2-difluoroethenyl)-2-fluoro-5-methyl-3-methylsulfanylaniline |
|---|---|
| PubChem CID | 170421458 |
| Molecular Formula | C10H10F3NS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-(2,2-difluoroethenyl)-2-fluoro-5-methyl-3-methylsulfanylaniline |
| SMILES | CSc1c(F)c(N)cc(C)c1C=C(F)F |
| InChI | InChI=1S/C10H10F3NS/c1-5-3-7(14)9(13)10(15-2)6(5)4-8(11)12/h3-4H,14H2,1-2H3 |
| InChIKey | UXCFWXJSWKAYMW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|