C16H25NO6 — CID 170444434
(2S)-2-[[(2S)-3,3-dimethyl-2-propan-2-yloxybutanoyl]oxymethoxy]-2-(1H-pyrrol-3-yl)acetic acid (PubChem CID 170444434) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3,3-dimethyl-2-propan-2-yloxybutanoyl]oxymethoxy]-2-(1H-pyrrol-3-yl)acetic acid.
| Compound Name | (2S)-2-[[(2S)-3,3-dimethyl-2-propan-2-yloxybutanoyl]oxymethoxy]-2-(1H-pyrrol-3-yl)acetic acid |
|---|---|
| PubChem CID | 170444434 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2S)-2-[[(2S)-3,3-dimethyl-2-propan-2-yloxybutanoyl]oxymethoxy]-2-(1H-pyrrol-3-yl)acetic acid |
| SMILES | CC(C)O[C@H](C(=O)OCO[C@H](C(=O)O)c1cc[nH]c1)C(C)(C)C |
| InChI | InChI=1S/C16H25NO6/c1-10(2)23-13(16(3,4)5)15(20)22-9-21-12(14(18)19)11-6-7-17-8-11/h6-8,10,12-13,17H,9H2,1-5H3,(H,18,19)/t12-,13+/m0/s1 |
| InChIKey | UAYDVGHSYKEHEZ-QWHCGFSZSA-N |
| XLogP | 2.50 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|