C14H19F3N4O — CID 170457736
(1-methyl-4-prop-2-enylpyrazol-5-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 170457736) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is (1-methyl-4-prop-2-enylpyrazol-5-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | (1-methyl-4-prop-2-enylpyrazol-5-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 170457736 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1-methyl-4-prop-2-enylpyrazol-5-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | C=CCc1cnn(C)c1C(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N4O/c1-3-4-11-9-18-19(2)12(11)13(22)21-7-5-20(6-8-21)10-14(15,16)17/h3,9H,1,4-8,10H2,2H3 |
| InChIKey | JOFPFABPEUZATG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|