C11H14O2S2 — CID 170479521
S-[4-[2-(hydroxymethyl)thiophen-3-yl]but-3-enyl] ethanethioate (PubChem CID 170479521) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is S-[4-[2-(hydroxymethyl)thiophen-3-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[2-(hydroxymethyl)thiophen-3-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170479521 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | S-[4-[2-(hydroxymethyl)thiophen-3-yl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccsc1CO |
| InChI | InChI=1S/C11H14O2S2/c1-9(13)14-6-3-2-4-10-5-7-15-11(10)8-12/h2,4-5,7,12H,3,6,8H2,1H3 |
| InChIKey | ZSZORUHKMNNAOY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|