C9H7F3N2O3 — CID 170484155
4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoic acid (PubChem CID 170484155) has the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. Its IUPAC name is 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoic acid.
| Compound Name | 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 170484155 |
| Molecular Formula | C9H7F3N2O3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C9H7F3N2O3/c10-9(11,12)7-5(2-1-3-6(15)16)8(17)14-4-13-7/h1-2,4H,3H2,(H,15,16)(H,13,14,17) |
| InChIKey | ITSWKOBBLKDYEJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |