C11H11F3N2O3 — CID 170796748
ethyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate (PubChem CID 170796748) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is ethyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate.
| Compound Name | ethyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate |
|---|---|
| PubChem CID | 170796748 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethyl 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C11H11F3N2O3/c1-2-19-8(17)5-3-4-7-9(11(12,13)14)15-6-16-10(7)18/h3-4,6H,2,5H2,1H3,(H,15,16,18) |
| InChIKey | RCTUOMAPOYACKV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |