C10H11BrO3S — CID 170498536
2-(4-bromobut-1-enyl)benzenesulfonic acid (PubChem CID 170498536) has the molecular formula C10H11BrO3S and a molecular weight of 291.17 g/mol. Its IUPAC name is 2-(4-bromobut-1-enyl)benzenesulfonic acid.
| Compound Name | 2-(4-bromobut-1-enyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 170498536 |
| Molecular Formula | C10H11BrO3S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 2-(4-bromobut-1-enyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1C=CCCBr |
| InChI | InChI=1S/C10H11BrO3S/c11-8-4-3-6-9-5-1-2-7-10(9)15(12,13)14/h1-3,5-7H,4,8H2,(H,12,13,14) |
| InChIKey | WRGKURGTPHLVAP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|