C23H26FNO5 — CID 170505635
N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-methyl-2-oxo-6-(oxolan-2-yl)pyran-3-carboxamide (PubChem CID 170505635) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-methyl-2-oxo-6-(oxolan-2-yl)pyran-3-carboxamide.
| Compound Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-methyl-2-oxo-6-(oxolan-2-yl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 170505635 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-methyl-2-oxo-6-(oxolan-2-yl)pyran-3-carboxamide |
| SMILES | Cc1cc(C2CCCO2)oc(=O)c1C(=O)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C23H26FNO5/c1-15-12-19(18-6-3-9-29-18)30-22(27)20(15)21(26)25-14-23(7-10-28-11-8-23)16-4-2-5-17(24)13-16/h2,4-5,12-13,18H,3,6-11,14H2,1H3,(H,25,26) |
| InChIKey | FAOCCMVTOQONLC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |