C28H35IrN2O3- — CID 170518839
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;4-(5-methyl-2-pyridinyl)-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide (PubChem CID 170518839) has the molecular formula C28H35IrN2O3- and a molecular weight of 639.82 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;4-(5-methyl-2-pyridinyl)-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;4-(5-methyl-2-pyridinyl)-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide |
|---|---|
| PubChem CID | 170518839 |
| Molecular Formula | C28H35IrN2O3- |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;4-(5-methyl-2-pyridinyl)-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1ccc(-c2[c-]cnc3c4c(oc23)CCCC4)nc1.[Ir] |
| InChI | InChI=1S/C17H15N2O.C11H20O2.Ir/c1-11-6-7-14(19-10-11)12-8-9-18-16-13-4-2-3-5-15(13)20-17(12)16;1-10(2,3)8(12)7-9(13)11(4,5)6;/h6-7,9-10H,2-5H2,1H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | YKOKIPJYJPQBKL-HXIBTQJOSA-N |
| XLogP | 6.96 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|