C21H21IrN2O3- — CID 170518780
(Z)-4-hydroxypent-3-en-2-one;iridium;4-pyridin-2-yl-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide (PubChem CID 170518780) has the molecular formula C21H21IrN2O3- and a molecular weight of 541.63 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-pyridin-2-yl-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-pyridin-2-yl-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide |
|---|---|
| PubChem CID | 170518780 |
| Molecular Formula | C21H21IrN2O3- |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-pyridin-2-yl-6,7,8,9-tetrahydro-3H-[1]benzofuro[3,2-b]pyridin-3-ide |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1cnc2c3c(oc2c1-c1ccccn1)CCCC3 |
| InChI | InChI=1S/C16H13N2O.C5H8O2.Ir/c1-2-7-14-12(5-1)15-16(19-14)11(8-10-18-15)13-6-3-4-9-17-13;1-4(6)3-5(2)7;/h3-4,6,9-10H,1-2,5,7H2;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SNDYMGHQNZVHPZ-LWFKIUJUSA-N |
| XLogP | 4.60 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|