C30H40IrNO3- — CID 170528305
2-(3H-1-benzofuran-3-id-2-yl)pyridine;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol (PubChem CID 170528305) has the molecular formula C30H40IrNO3- and a molecular weight of 654.87 g/mol. Its IUPAC name is 2-(3H-1-benzofuran-3-id-2-yl)pyridine;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol.
| Compound Name | 2-(3H-1-benzofuran-3-id-2-yl)pyridine;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
|---|---|
| PubChem CID | 170528305 |
| Molecular Formula | C30H40IrNO3- |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | 2-(3H-1-benzofuran-3-id-2-yl)pyridine;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
| SMILES | CCC1(CC)CCC2CC(CC)(CC)C(O)C2C1O.[Ir].[c-]1c(-c2ccccn2)oc2ccccc12 |
| InChI | InChI=1S/C17H32O2.C13H8NO.Ir/c1-5-16(6-2)10-9-12-11-17(7-3,8-4)15(19)13(12)14(16)18;1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h12-15,18-19H,5-11H2,1-4H3;1-8H;/q;-1; |
| InChIKey | WAPBLQDEFQZBRR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|