C23H24N3OSi+ — CID 170530605
8-(1,5-dimethyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine-2-carbonitrile (PubChem CID 170530605) has the molecular formula C23H24N3OSi+ and a molecular weight of 386.55 g/mol. Its IUPAC name is 8-(1,5-dimethyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine-2-carbonitrile.
| Compound Name | 8-(1,5-dimethyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 170530605 |
| Molecular Formula | C23H24N3OSi+ |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 8-(1,5-dimethyl-4-trimethylsilylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine-2-carbonitrile |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2nc(C#N)ccc23)cc1[Si](C)(C)C |
| InChI | InChI=1S/C23H24N3OSi/c1-14-7-9-17-18-10-8-16(12-24)25-23(18)27-22(17)21(14)19-11-20(28(4,5)6)15(2)13-26(19)3/h7-11,13H,1-6H3/q+1 |
| InChIKey | ULMLLGAWYNZHHD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|