C25H29ClN4O4 — CID 17053685
N-tert-butyl-2-[1-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]naphthalen-2-yl]oxyacetamide (PubChem CID 17053685) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-tert-butyl-2-[1-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 17053685 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-tert-butyl-2-[1-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]naphthalen-2-yl]oxyacetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc2ccccc2c1CNCCNc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C25H29ClN4O4/c1-25(2,3)29-24(31)16-34-23-11-8-17-6-4-5-7-19(17)20(23)15-27-12-13-28-22-10-9-18(30(32)33)14-21(22)26/h4-11,14,27-28H,12-13,15-16H2,1-3H3,(H,29,31) |
| InChIKey | HZXDWSQCXKZWCU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|