C27H34FN7O — CID 170547710
3-[2-fluoro-4-[1-[(3S)-3,4,5-trimethylpiperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 170547710) has the molecular formula C27H34FN7O and a molecular weight of 491.62 g/mol. Its IUPAC name is 3-[2-fluoro-4-[1-[(3S)-3,4,5-trimethylpiperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-fluoro-4-[1-[(3S)-3,4,5-trimethylpiperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170547710 |
| Molecular Formula | C27H34FN7O |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 3-[2-fluoro-4-[1-[(3S)-3,4,5-trimethylpiperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CC1CN(c2nnc3cnc4ccc(-c5ccc(OCCCN(C)C)c(F)c5)cc4n23)C[C@H](C)N1C |
| InChI | InChI=1S/C27H34FN7O/c1-18-16-34(17-19(2)33(18)5)27-31-30-26-15-29-23-9-7-21(14-24(23)35(26)27)20-8-10-25(22(28)13-20)36-12-6-11-32(3)4/h7-10,13-15,18-19H,6,11-12,16-17H2,1-5H3/t18-,19?/m0/s1 |
| InChIKey | KEEFOWOIXXPWGE-OYKVQYDMSA-N |
| XLogP | 3.94 |
| TPSA | 62.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|