C12H8Cl2N2 — CID 170554791
7,8-dichloro-2,3-dihydrophenazine (PubChem CID 170554791) has the molecular formula C12H8Cl2N2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 7,8-dichloro-2,3-dihydrophenazine.
| Compound Name | 7,8-dichloro-2,3-dihydrophenazine |
|---|---|
| PubChem CID | 170554791 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 7,8-dichloro-2,3-dihydrophenazine |
| SMILES | Clc1cc2nc3c(nc2cc1Cl)=CCCC=3 |
| InChI | InChI=1S/C12H8Cl2N2/c13-7-5-11-12(6-8(7)14)16-10-4-2-1-3-9(10)15-11/h3-6H,1-2H2 |
| InChIKey | MOLVLZMPHKCOMG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |