C24H26N2O4 — CID 170560933
6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 170560933) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 170560933 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)CN3C[C@H]4C[C@H](Oc5ccccc5)C[C@@]4(O)C3)ccc2N1 |
| InChI | InChI=1S/C24H26N2O4/c27-22(17-6-8-21-16(10-17)7-9-23(28)25-21)14-26-13-18-11-20(12-24(18,29)15-26)30-19-4-2-1-3-5-19/h1-6,8,10,18,20,29H,7,9,11-15H2,(H,25,28)/t18-,20+,24-/m1/s1 |
| InChIKey | BLZBUQXFDJSEKN-LJFZDNNRSA-N |
| XLogP | 2.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |