C50H58F2N4O8 — CID 174185831
7-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 174185831) has the molecular formula C50H58F2N4O8 and a molecular weight of 881.03 g/mol. Its IUPAC name is 7-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 174185831 |
| Molecular Formula | C50H58F2N4O8 |
| Molecular Weight | 881.03 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | 7-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(O)CN3C[C@H]4C[C@H](Oc5ccccc5)C[C@@]4(O)C3)cc(F)c2N1.O=C1CCCc2cc(C(O)CN3C[C@H]4C[C@H](Oc5ccccc5)C[C@@]4(O)C3)cc(F)c2N1 |
| InChI | InChI=1S/2C25H29FN2O4/c2*26-21-10-17(9-16-5-4-8-23(30)27-24(16)21)22(29)14-28-13-18-11-20(12-25(18,31)15-28)32-19-6-2-1-3-7-19/h2*1-3,6-7,9-10,18,20,22,29,31H,4-5,8,11-15H2,(H,27,30)/t2*18-,20+,22?,25-/m11/s1 |
| InChIKey | UQWFGKKXMRDLFY-JFZPDFFFSA-N |
| XLogP | 6.08 |
| TPSA | 164.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |