C27H31F2N3O4 — CID 170560917
(3aR,5R,6aS)-5-(2,4-difluorophenoxy)-2-[(2R)-2-hydroxy-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-ol (PubChem CID 170560917) has the molecular formula C27H31F2N3O4 and a molecular weight of 499.56 g/mol. Its IUPAC name is (3aR,5R,6aS)-5-(2,4-difluorophenoxy)-2-[(2R)-2-hydroxy-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-ol.
| Compound Name | (3aR,5R,6aS)-5-(2,4-difluorophenoxy)-2-[(2R)-2-hydroxy-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-ol |
|---|---|
| PubChem CID | 170560917 |
| Molecular Formula | C27H31F2N3O4 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (3aR,5R,6aS)-5-(2,4-difluorophenoxy)-2-[(2R)-2-hydroxy-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-ol |
| SMILES | O[C@@H](CN1C[C@@H]2C[C@@H](Oc3ccc(F)cc3F)C[C@]2(O)C1)c1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C27H31F2N3O4/c28-20-5-7-25(22(29)11-20)36-21-10-19-14-31(16-27(19,34)12-21)15-24(33)17-4-6-23-18(9-17)13-30-32(23)26-3-1-2-8-35-26/h4-7,9,11,13,19,21,24,26,33-34H,1-3,8,10,12,14-16H2/t19-,21+,24-,26?,27-/m0/s1 |
| InChIKey | BCAVIFBROMLFGX-OEYFIQPSSA-N |
| XLogP | 3.95 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |