C13H11N7 — CID 170562506
2-pyridin-2-yl-5-(triazin-4-yl)pyridine-3,4-diamine (PubChem CID 170562506) has the molecular formula C13H11N7 and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-pyridin-2-yl-5-(triazin-4-yl)pyridine-3,4-diamine.
| Compound Name | 2-pyridin-2-yl-5-(triazin-4-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 170562506 |
| Molecular Formula | C13H11N7 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-pyridin-2-yl-5-(triazin-4-yl)pyridine-3,4-diamine |
| SMILES | Nc1c(-c2ccnnn2)cnc(-c2ccccn2)c1N |
| InChI | InChI=1S/C13H11N7/c14-11-8(9-4-6-18-20-19-9)7-17-13(12(11)15)10-3-1-2-5-16-10/h1-7H,15H2,(H2,14,17) |
| InChIKey | WJGMLOOPFZRZDU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |