C18H18O7 — CID 170565098
2,3-dihydroxy-5-[2-[2-(hydroxymethoxy)phenyl]ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one (PubChem CID 170565098) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2,3-dihydroxy-5-[2-[2-(hydroxymethoxy)phenyl]ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one.
| Compound Name | 2,3-dihydroxy-5-[2-[2-(hydroxymethoxy)phenyl]ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one |
|---|---|
| PubChem CID | 170565098 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2,3-dihydroxy-5-[2-[2-(hydroxymethoxy)phenyl]ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one |
| SMILES | O=c1cc(CCc2ccccc2OCO)oc2c1C1OC1C(O)C2O |
| InChI | InChI=1S/C18H18O7/c19-8-23-12-4-2-1-3-9(12)5-6-10-7-11(20)13-16(24-10)14(21)15(22)18-17(13)25-18/h1-4,7,14-15,17-19,21-22H,5-6,8H2 |
| InChIKey | KQBTZQSDMVYIOB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|