C17H18O6 — CID 154572705
(5R,6S,7R)-5,6-dihydroxy-7-(hydroxymethyl)-2-(2-phenylethyl)-6,7-dihydro-5H-pyrano[2,3-b]pyran-4-one (PubChem CID 154572705) has the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. Its IUPAC name is (5R,6S,7R)-5,6-dihydroxy-7-(hydroxymethyl)-2-(2-phenylethyl)-6,7-dihydro-5H-pyrano[2,3-b]pyran-4-one.
| Compound Name | (5R,6S,7R)-5,6-dihydroxy-7-(hydroxymethyl)-2-(2-phenylethyl)-6,7-dihydro-5H-pyrano[2,3-b]pyran-4-one |
|---|---|
| PubChem CID | 154572705 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5R,6S,7R)-5,6-dihydroxy-7-(hydroxymethyl)-2-(2-phenylethyl)-6,7-dihydro-5H-pyrano[2,3-b]pyran-4-one |
| SMILES | O=c1cc(CCc2ccccc2)oc2c1[C@@H](O)[C@H](O)[C@@H](CO)O2 |
| InChI | InChI=1S/C17H18O6/c18-9-13-15(20)16(21)14-12(19)8-11(22-17(14)23-13)7-6-10-4-2-1-3-5-10/h1-5,8,13,15-16,18,20-21H,6-7,9H2/t13-,15-,16-/m1/s1 |
| InChIKey | FMILQAVHDCGYRA-FVQBIDKESA-N |
| XLogP | 0.57 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |