C21H22O8 — CID 23258668
[(5S,6S,7R,8S)-8-acetyloxy-6,7-dihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl] acetate (PubChem CID 23258668) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(5S,6S,7R,8S)-8-acetyloxy-6,7-dihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl] acetate.
| Compound Name | [(5S,6S,7R,8S)-8-acetyloxy-6,7-dihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl] acetate |
|---|---|
| PubChem CID | 23258668 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(5S,6S,7R,8S)-8-acetyloxy-6,7-dihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1c2oc(CCc3ccccc3)cc(=O)c2[C@H](OC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22O8/c1-11(22)27-19-16-15(24)10-14(9-8-13-6-4-3-5-7-13)29-20(16)21(28-12(2)23)18(26)17(19)25/h3-7,10,17-19,21,25-26H,8-9H2,1-2H3/t17-,18+,19-,21-/m0/s1 |
| InChIKey | OZOLNPLWQBSPJK-JTJHWIPRSA-N |
| XLogP | 1.37 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |