C10H13FN5O6PS — CID 170566022
(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluorooxolane-3,4-diol (PubChem CID 170566022) has the molecular formula C10H13FN5O6PS and a molecular weight of 381.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluorooxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluorooxolane-3,4-diol |
|---|---|
| PubChem CID | 170566022 |
| Molecular Formula | C10H13FN5O6PS |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluorooxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(O)=S)[C@@H](O)[C@]1(O)F |
| InChI | InChI=1S/C10H13FN5O6PS/c11-10(18)6(17)4(1-21-23(19,20)24)22-9(10)16-3-15-5-7(12)13-2-14-8(5)16/h2-4,6,9,17-18H,1H2,(H2,12,13,14)(H2,19,20,24)/t4-,6-,9-,10-/m1/s1 |
| InChIKey | WXRCEILKXWLYCA-GIWSHQQXSA-N |
| XLogP | -1.45 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|