C31H33N5O2S — CID 170567627
6-[3-[bis[(4-methoxyphenyl)methyl]amino]sulfanylazetidin-1-yl]-3-(phenyliminomethyl)pyridin-2-amine (PubChem CID 170567627) has the molecular formula C31H33N5O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is 6-[3-[bis[(4-methoxyphenyl)methyl]amino]sulfanylazetidin-1-yl]-3-(phenyliminomethyl)pyridin-2-amine.
| Compound Name | 6-[3-[bis[(4-methoxyphenyl)methyl]amino]sulfanylazetidin-1-yl]-3-(phenyliminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170567627 |
| Molecular Formula | C31H33N5O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 6-[3-[bis[(4-methoxyphenyl)methyl]amino]sulfanylazetidin-1-yl]-3-(phenyliminomethyl)pyridin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)SC2CN(c3ccc(/C=N/c4ccccc4)c(N)n3)C2)cc1 |
| InChI | InChI=1S/C31H33N5O2S/c1-37-27-13-8-23(9-14-27)19-36(20-24-10-15-28(38-2)16-11-24)39-29-21-35(22-29)30-17-12-25(31(32)34-30)18-33-26-6-4-3-5-7-26/h3-18,29H,19-22H2,1-2H3,(H2,32,34)/b33-18+ |
| InChIKey | UKQWGVHAYBPIFM-DPNNOFEESA-N |
| XLogP | 5.97 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|