C24H23F2N3O5S — CID 170568314
ethyl 2-[acetyl-[(2,6-difluorophenyl)methyl]amino]-4-(methylaminomethyl)-5-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 170568314) has the molecular formula C24H23F2N3O5S and a molecular weight of 503.53 g/mol. Its IUPAC name is ethyl 2-[acetyl-[(2,6-difluorophenyl)methyl]amino]-4-(methylaminomethyl)-5-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[acetyl-[(2,6-difluorophenyl)methyl]amino]-4-(methylaminomethyl)-5-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 170568314 |
| Molecular Formula | C24H23F2N3O5S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | ethyl 2-[acetyl-[(2,6-difluorophenyl)methyl]amino]-4-(methylaminomethyl)-5-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N(Cc2c(F)cccc2F)C(C)=O)sc(-c2ccc([N+](=O)[O-])cc2)c1CNC |
| InChI | InChI=1S/C24H23F2N3O5S/c1-4-34-24(31)21-17(12-27-3)22(15-8-10-16(11-9-15)29(32)33)35-23(21)28(14(2)30)13-18-19(25)6-5-7-20(18)26/h5-11,27H,4,12-13H2,1-3H3 |
| InChIKey | IGCMJIUCNQIZPO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|