C24H21BrF2N2O6S — CID 175514366
[2-[4-(bromomethyl)-5-(4-nitrophenyl)thiophen-3-yl]-2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]ethyl] formate (PubChem CID 175514366) has the molecular formula C24H21BrF2N2O6S and a molecular weight of 583.41 g/mol. Its IUPAC name is [2-[4-(bromomethyl)-5-(4-nitrophenyl)thiophen-3-yl]-2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]ethyl] formate.
| Compound Name | [2-[4-(bromomethyl)-5-(4-nitrophenyl)thiophen-3-yl]-2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]ethyl] formate |
|---|---|
| PubChem CID | 175514366 |
| Molecular Formula | C24H21BrF2N2O6S |
| Molecular Weight | 583.41 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | [2-[4-(bromomethyl)-5-(4-nitrophenyl)thiophen-3-yl]-2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]ethyl] formate |
| SMILES | CCOC(=O)N(Cc1c(F)cccc1F)C(COC=O)c1csc(-c2ccc([N+](=O)[O-])cc2)c1CBr |
| InChI | InChI=1S/C24H21BrF2N2O6S/c1-2-35-24(31)28(11-18-20(26)4-3-5-21(18)27)22(12-34-14-30)19-13-36-23(17(19)10-25)15-6-8-16(9-7-15)29(32)33/h3-9,13-14,22H,2,10-12H2,1H3 |
| InChIKey | AHEOWESHYUDAIT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|