C19H20ClN3O2 — CID 170578167
1-[3-[4-amino-5-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-2-chlorophenyl]azetidin-1-yl]ethanone (PubChem CID 170578167) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-2-chlorophenyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-amino-5-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-2-chlorophenyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170578167 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-[3-[4-amino-5-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-2-chlorophenyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(c2cc(/C=C(\N)c3ccccc3O)c(N)cc2Cl)C1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-11(24)23-9-13(10-23)15-6-12(17(21)8-16(15)20)7-18(22)14-4-2-3-5-19(14)25/h2-8,13,25H,9-10,21-22H2,1H3/b18-7- |
| InChIKey | BSUMCXIDMKIVMD-WSVATBPTSA-N |
| XLogP | 3.03 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|