C16H15ClN4 — CID 170580287
5-[[1-(3-chlorophenyl)cyclobutyl]methylamino]pyrimidine-2-carbonitrile (PubChem CID 170580287) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is 5-[[1-(3-chlorophenyl)cyclobutyl]methylamino]pyrimidine-2-carbonitrile.
| Compound Name | 5-[[1-(3-chlorophenyl)cyclobutyl]methylamino]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 170580287 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-[[1-(3-chlorophenyl)cyclobutyl]methylamino]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1ncc(NCC2(c3cccc(Cl)c3)CCC2)cn1 |
| InChI | InChI=1S/C16H15ClN4/c17-13-4-1-3-12(7-13)16(5-2-6-16)11-21-14-9-19-15(8-18)20-10-14/h1,3-4,7,9-10,21H,2,5-6,11H2 |
| InChIKey | NVBOBPLARKXXDC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |