C16H22N2O4 — CID 170584059
ethane;N-formyl-4-(7-methyl-2-oxo-1,3-benzoxazol-3-yl)pentanamide (PubChem CID 170584059) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethane;N-formyl-4-(7-methyl-2-oxo-1,3-benzoxazol-3-yl)pentanamide.
| Compound Name | ethane;N-formyl-4-(7-methyl-2-oxo-1,3-benzoxazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 170584059 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethane;N-formyl-4-(7-methyl-2-oxo-1,3-benzoxazol-3-yl)pentanamide |
| SMILES | CC.Cc1cccc2c1oc(=O)n2C(C)CCC(=O)NC=O |
| InChI | InChI=1S/C14H16N2O4.C2H6/c1-9-4-3-5-11-13(9)20-14(19)16(11)10(2)6-7-12(18)15-8-17;1-2/h3-5,8,10H,6-7H2,1-2H3,(H,15,17,18);1-2H3 |
| InChIKey | YUGAFIIBXHLYAU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|