C21H39NO2 — CID 170584255
11-methyl-10-oxododecanal;N,N,4-trimethylpent-2-yn-1-amine (PubChem CID 170584255) has the molecular formula C21H39NO2 and a molecular weight of 337.55 g/mol. Its IUPAC name is 11-methyl-10-oxododecanal;N,N,4-trimethylpent-2-yn-1-amine.
| Compound Name | 11-methyl-10-oxododecanal;N,N,4-trimethylpent-2-yn-1-amine |
|---|---|
| PubChem CID | 170584255 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | 11-methyl-10-oxododecanal;N,N,4-trimethylpent-2-yn-1-amine |
| SMILES | CC(C)C#CCN(C)C.CC(C)C(=O)CCCCCCCCC=O |
| InChI | InChI=1S/C13H24O2.C8H15N/c1-12(2)13(15)10-8-6-4-3-5-7-9-11-14;1-8(2)6-5-7-9(3)4/h11-12H,3-10H2,1-2H3;8H,7H2,1-4H3 |
| InChIKey | BNRFQLFRZFRJGQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|