C26H34Cl2FN5O4Si — CID 170590013
2-[3-[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxypropoxy]-5-fluoro-4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)aniline (PubChem CID 170590013) has the molecular formula C26H34Cl2FN5O4Si and a molecular weight of 598.58 g/mol. Its IUPAC name is 2-[3-[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxypropoxy]-5-fluoro-4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)aniline.
| Compound Name | 2-[3-[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxypropoxy]-5-fluoro-4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)aniline |
|---|---|
| PubChem CID | 170590013 |
| Molecular Formula | C26H34Cl2FN5O4Si |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[3-[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxypropoxy]-5-fluoro-4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)aniline |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(OCCCOc3cc(N4CC5CC4CO5)c(F)cc3N)nc(Cl)nc21 |
| InChI | InChI=1S/C26H34Cl2FN5O4Si/c1-39(2,3)8-7-35-15-33-13-18(27)23-24(33)31-26(28)32-25(23)37-6-4-5-36-22-11-21(19(29)10-20(22)30)34-12-17-9-16(34)14-38-17/h10-11,13,16-17H,4-9,12,14-15,30H2,1-3H3 |
| InChIKey | MJXSGAUTWJFXPJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|