C26H32Cl2FN5O6Si — CID 170590050
2-[[2,5-dichloro-4-[3-[4-fluoro-2-nitro-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)phenoxy]propoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 170590050) has the molecular formula C26H32Cl2FN5O6Si and a molecular weight of 628.56 g/mol. Its IUPAC name is 2-[[2,5-dichloro-4-[3-[4-fluoro-2-nitro-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)phenoxy]propoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,5-dichloro-4-[3-[4-fluoro-2-nitro-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)phenoxy]propoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170590050 |
| Molecular Formula | C26H32Cl2FN5O6Si |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | 2-[[2,5-dichloro-4-[3-[4-fluoro-2-nitro-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)phenoxy]propoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(OCCCOc3cc(N4CC5CC4CO5)c(F)cc3[N+](=O)[O-])nc(Cl)nc21 |
| InChI | InChI=1S/C26H32Cl2FN5O6Si/c1-41(2,3)8-7-37-15-32-13-18(27)23-24(32)30-26(28)31-25(23)39-6-4-5-38-22-11-20(19(29)10-21(22)34(35)36)33-12-17-9-16(33)14-40-17/h10-11,13,16-17H,4-9,12,14-15H2,1-3H3 |
| InChIKey | DYISCDOHAUTQCU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 114.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|