C8H12N2O — CID 170603983
ethane;5-ethyl-1,2-oxazole-3-carbonitrile (PubChem CID 170603983) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is ethane;5-ethyl-1,2-oxazole-3-carbonitrile.
| Compound Name | ethane;5-ethyl-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 170603983 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | ethane;5-ethyl-1,2-oxazole-3-carbonitrile |
| SMILES | CC.CCc1cc(C#N)no1 |
| InChI | InChI=1S/C6H6N2O.C2H6/c1-2-6-3-5(4-7)8-9-6;1-2/h3H,2H2,1H3;1-2H3 |
| InChIKey | IZBZCMBMWZKUFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |