About ethane;5-ethyl-1,2-oxazole-3-carbonitrile
ethane;5-ethyl-1,2-oxazole-3-carbonitrile (PubChem CID 170603983) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is ethane;5-ethyl-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | ethane;5-ethyl-1,2-oxazole-3-carbonitrile |
| PubChem CID | 170603983 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | ethane;5-ethyl-1,2-oxazole-3-carbonitrile |
| SMILES | CC.CCc1cc(C#N)no1 |
| InChI | InChI=1S/C6H6N2O.C2H6/c1-2-6-3-5(4-7)8-9-6;1-2/h3H,2H2,1H3;1-2H3 |
| InChIKey | IZBZCMBMWZKUFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-ethyl-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-1,2-oxazole-3-carbonitrile?
The IUPAC name of ethane;5-ethyl-1,2-oxazole-3-carbonitrile (CID 170603983) is ethane;5-ethyl-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for ethane;5-ethyl-1,2-oxazole-3-carbonitrile?
The canonical SMILES for ethane;5-ethyl-1,2-oxazole-3-carbonitrile is CC.CCc1cc(C#N)no1.
What is the InChIKey of ethane;5-ethyl-1,2-oxazole-3-carbonitrile?
The InChIKey is IZBZCMBMWZKUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C2H6/c1-2-6-3-5(4-7)8-9-6;1-2/h3H,2H2,1H3;1-2H3.
What are the key properties of ethane;5-ethyl-1,2-oxazole-3-carbonitrile?
ethane;5-ethyl-1,2-oxazole-3-carbonitrile has a molecular weight of 152.20 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 170603983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).