C25H32O4 — CID 170607523
[4-hydroxy-3-methyl-2-[(E)-2,4,5-trimethylhex-3-en-2-yl]naphthalen-1-yl] 3-methyl-4-oxobutanoate (PubChem CID 170607523) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is [4-hydroxy-3-methyl-2-[(E)-2,4,5-trimethylhex-3-en-2-yl]naphthalen-1-yl] 3-methyl-4-oxobutanoate.
| Compound Name | [4-hydroxy-3-methyl-2-[(E)-2,4,5-trimethylhex-3-en-2-yl]naphthalen-1-yl] 3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 170607523 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [4-hydroxy-3-methyl-2-[(E)-2,4,5-trimethylhex-3-en-2-yl]naphthalen-1-yl] 3-methyl-4-oxobutanoate |
| SMILES | C/C(=C\C(C)(C)c1c(C)c(O)c2ccccc2c1OC(=O)CC(C)C=O)C(C)C |
| InChI | InChI=1S/C25H32O4/c1-15(2)17(4)13-25(6,7)22-18(5)23(28)19-10-8-9-11-20(19)24(22)29-21(27)12-16(3)14-26/h8-11,13-16,28H,12H2,1-7H3/b17-13+ |
| InChIKey | NUJSBVJDVPJWNX-GHRIWEEISA-N |
| XLogP | 5.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|